Acetic acid,2-[[(Z)-[1-(2-aMino-4-thiazolyl)-2-(2-benzothiazolylthio)-2-oxoethylidene]aMino]oxy]-,Methyl ester - Names and Identifiers
Name | 2-Mercaptobenzotriazoyl-(Z)-2-(2-Aminothiazole-4-Yl)-2-(Methyoxycarbonyl Methoxyimino)Acetate (Mica Ester)
|
Synonyms | Faem (S)-2-Benzothiazoly S-2-Benzothiazolyl(Z)-2-(2-Aminothiazol-4-Yl)-2-Methoxycarbonylmethoxyiminothioactate (S)-2-Benzothiazolyl (Z)-2-(2-aminothiazole-4-yl)-2-methoxycarbonylmethoxyiminothioacetate (S)-2-BENZOTHIAZOLYL (Z)-2-(2-AMINOTHIAZOLE-4-YL)-2-METHOXYCARBONYLMETHOXYIMINOTHIOACETATE (S)-2-Benzothiazolyl (Z)-2-(2-Aminothiazole-4-Yl)-2-Methoxycarbonylmethoxyiminothioacetate S-2-Benzothiazolyl-(Z)-2-(2-Aminothiazol-4-Yl)-2-Methyloxycarbonyl Methoxyimino Thioacetate (S)-2-Benzothiazolyl (Z)-2-(Amino-Thiazole-4-yl)-2-Methoxy-carbonyl-methoxyiminothio-acetate S-2-Benzothiazolyl( Z )-2-(2-Aminothiazol-4-Yl)-2-Methoxycarbonylmethoxyimino-Thioacetate (Faem) [(Z)-[1-(2-Amino-4-Thiazoly)-2-(2-Benzothiazolylthio)-2-Oxoethylidene]Amino]-Acetic Acid Methyl Ester (Z)-Methyl 2-(((1-(2-aMinothiazol-4-yl)-2-(benzo[d]thiazol-2-ylthio)-2-oxoethylidene)aMino)oxy)acetate S-2-Benzothiazolyl(Z)-2-(2-Aminothiazol-4-Yl)-2-Methoxycarbonylmethoxy Iminothioacetate ( Mica Ester ) 2-MERCAPTOBENZOTRIAZOYL-(Z)-2-(2-AMINOTHIAZOLE-4-YL)-2-(METHYOXYCARBONYL METHOXYIMINO)ACETATE (MICA ESTER) 2-Mercaptobenzotriazoyl-(Z)-2-(2-Aminothiazole-4-Yl)-2-(Methyoxycarbonyl Methoxyimino)Acetate (Mica Ester) Acetic acid,2-[[(Z)-[1-(2-aMino-4-thiazolyl)-2-(2-benzothiazolylthio)-2-oxoethylidene]aMino]oxy]-,Methyl ester Methyl ({[(1Z)-1-(2-Amino-1,3-Thiazol-4-Yl)-2-(1,3-Benzothiazol-2-Ylsulfanyl)-2-Oxoethylidene]Amino}Oxy)Acetate 2-[[1-(2-amino-4-thiazolyl)-2-(1,3-benzothiazol-2-yloxy)-2-sulfanylideneethylidene]amino]oxyacetic acid methyl ester
|
CAS | 246035-38-1
|
InChI | InChI=1/C15H12N4O4S3/c1-22-11(20)6-23-19-12(9-7-24-14(16)17-9)13(21)26-15-18-8-4-2-3-5-10(8)25-15/h2-5,7H,6H2,1H3,(H2,16,17)/b19-12- |
Acetic acid,2-[[(Z)-[1-(2-aMino-4-thiazolyl)-2-(2-benzothiazolylthio)-2-oxoethylidene]aMino]oxy]-,Methyl ester - Physico-chemical Properties
Molecular Formula | C15H12N4O4S3
|
Molar Mass | 408.48 |
Density | 1.63±0.1 g/cm3(Predicted) |
Boling Point | 611.0±61.0 °C(Predicted) |
Flash Point | 323.321°C |
Vapor Presure | 0mmHg at 25°C |
pKa | 0?+-.0.10(Predicted) |
Storage Condition | 2-8°C |
Refractive Index | 1.761 |
Acetic acid,2-[[(Z)-[1-(2-aMino-4-thiazolyl)-2-(2-benzothiazolylthio)-2-oxoethylidene]aMino]oxy]-,Methyl ester - Introduction
-(Z)-2-(2-Aminothiazole-4-Yl)-2-(methyloxycarbonyl Methoxyimino)Acetate (Mica Ester) is a compound with the following properties:
1. Appearance: Mica Ester is a white solid.
2. Solubility: It is soluble in many organic solvents (such as dimethyl sulfoxide and dichloromethane).
3. Stability: Mica Ester is stable and not easily decomposed by light, moisture and thermal decomposition.
Mica Ester has the following uses in chemical experiments and research:
1. Crosslinking agent: Mica ester can be used as a crosslinking reagent, for example, in the crosslinking reaction of polymers and fiber materials.
2. Sustained-release agent: It can be used as a wrapping material for microcapsules and play a role in the slow release of drugs or chemical substances.
The preparation method of Mica Ester has the following steps:
1. First, under appropriate reaction conditions, benzothiazole and aminothiazole are reacted to generate the target intermediate.
2. Then, the intermediate is reacted with methoxyimine and mercaptoethanol under basic conditions.
3. Finally, the intermediate is reacted with methyl formate through esterification to obtain the final product Mica ester.
pay attention to the following safety precautions when using and handling Mica ester:
1. Mica ester may be irritating to the eyes and skin, and should be rinsed with plenty of water immediately after contact.
2. During operation and storage, avoid skin contact and inhalation of dust or vapor. Use personal protective equipment such as gloves, glasses and protective clothing.
3. Should be operated in a well ventilated environment, avoid inhalation of gas or dust.
4. Before use, read and understand the relevant safety data sheets in detail, and operate in accordance with operating procedures and protective measures.
Please note that due to the special nature of chemicals, the information provided is for reference only. The specific use and operation still need to be cautious and follow the laboratory safety operation specifications.
Last Update:2024-04-09 21:01:54